C26H30N4O3S — CID 142636198
(2S)-N-benzyl-3-(3-carbamimidoylphenyl)-2-[(4-propylphenyl)sulfonylamino]propanamide (PubChem CID 142636198) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is (2S)-N-benzyl-3-(3-carbamimidoylphenyl)-2-[(4-propylphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-benzyl-3-(3-carbamimidoylphenyl)-2-[(4-propylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 142636198 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (2S)-N-benzyl-3-(3-carbamimidoylphenyl)-2-[(4-propylphenyl)sulfonylamino]propanamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2ccc(CCC)cc2)C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C26H30N4O3S/c1-2-7-19-12-14-23(15-13-19)34(32,33)30-24(17-21-10-6-11-22(16-21)25(27)28)26(31)29-18-20-8-4-3-5-9-20/h3-6,8-16,24,30H,2,7,17-18H2,1H3,(H3,27,28)(H,29,31)/t24-/m0/s1 |
| InChIKey | MGWLFORWFZDKSP-DEOSSOPVSA-N |
| XLogP | 3.13 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|