C21H25N5O5S2 — CID 10624948
ethyl 3-(3-carbamimidoylphenyl)-2-[[2-[(4-carbamothioylphenyl)sulfonylamino]acetyl]amino]propanoate (PubChem CID 10624948) has the molecular formula C21H25N5O5S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is ethyl 3-(3-carbamimidoylphenyl)-2-[[2-[(4-carbamothioylphenyl)sulfonylamino]acetyl]amino]propanoate.
| Compound Name | ethyl 3-(3-carbamimidoylphenyl)-2-[[2-[(4-carbamothioylphenyl)sulfonylamino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 10624948 |
| Molecular Formula | C21H25N5O5S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | ethyl 3-(3-carbamimidoylphenyl)-2-[[2-[(4-carbamothioylphenyl)sulfonylamino]acetyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1cccc(CC(NC(=O)CNS(=O)(=O)c2ccc(C(N)=S)cc2)C(=O)OCC)c1 |
| InChI | InChI=1S/C21H25N5O5S2/c1-2-31-21(28)17(11-13-4-3-5-15(10-13)19(22)23)26-18(27)12-25-33(29,30)16-8-6-14(7-9-16)20(24)32/h3-10,17,25H,2,11-12H2,1H3,(H3,22,23)(H2,24,32)(H,26,27) |
| InChIKey | YFHANJZAFYUYQQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 177.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|