C11H15N3O3S2 — CID 43567096
2-[(3-carbamothioylphenyl)sulfonylamino]-N-ethylacetamide (PubChem CID 43567096) has the molecular formula C11H15N3O3S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-[(3-carbamothioylphenyl)sulfonylamino]-N-ethylacetamide.
| Compound Name | 2-[(3-carbamothioylphenyl)sulfonylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43567096 |
| Molecular Formula | C11H15N3O3S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[(3-carbamothioylphenyl)sulfonylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNS(=O)(=O)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C11H15N3O3S2/c1-2-13-10(15)7-14-19(16,17)9-5-3-4-8(6-9)11(12)18/h3-6,14H,2,7H2,1H3,(H2,12,18)(H,13,15) |
| InChIKey | JCJVGYAFCJQUIA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|