C14H21N3O2S2 — CID 60857196
3-[(1-ethylpyrrolidin-3-yl)methylsulfamoyl]benzenecarbothioamide (PubChem CID 60857196) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-[(1-ethylpyrrolidin-3-yl)methylsulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[(1-ethylpyrrolidin-3-yl)methylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 60857196 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-[(1-ethylpyrrolidin-3-yl)methylsulfamoyl]benzenecarbothioamide |
| SMILES | CCN1CCC(CNS(=O)(=O)c2cccc(C(N)=S)c2)C1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-2-17-7-6-11(10-17)9-16-21(18,19)13-5-3-4-12(8-13)14(15)20/h3-5,8,11,16H,2,6-7,9-10H2,1H3,(H2,15,20) |
| InChIKey | ITZFBDMCCYADRS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|