C12H16N2O4S3 — CID 81042057
3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]benzenecarbothioamide (PubChem CID 81042057) has the molecular formula C12H16N2O4S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 81042057 |
| Molecular Formula | C12H16N2O4S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(S(=O)(=O)NCC2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H16N2O4S3/c13-12(19)9-3-1-4-10(7-9)21(17,18)14-8-11-5-2-6-20(11,15)16/h1,3-4,7,11,14H,2,5-6,8H2,(H2,13,19) |
| InChIKey | LFIQPVULWDJOQV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|