C10H16N4O4S2 — CID 81040484
N-[(1,1-dioxothiolan-2-yl)methyl]-2-hydrazinylpyridine-4-sulfonamide (PubChem CID 81040484) has the molecular formula C10H16N4O4S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-2-hydrazinylpyridine-4-sulfonamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-hydrazinylpyridine-4-sulfonamide |
|---|---|
| PubChem CID | 81040484 |
| Molecular Formula | C10H16N4O4S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-2-hydrazinylpyridine-4-sulfonamide |
| SMILES | NNc1cc(S(=O)(=O)NCC2CCCS2(=O)=O)ccn1 |
| InChI | InChI=1S/C10H16N4O4S2/c11-14-10-6-8(3-4-12-10)20(17,18)13-7-9-2-1-5-19(9,15)16/h3-4,6,9,13H,1-2,5,7,11H2,(H,12,14) |
| InChIKey | RWKUBXJQRUYEOZ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|