C12H18N2O4S2 — CID 81038747
2-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 81038747) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | 2-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 81038747 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCCS2(=O)=O)c(N)c1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-9-4-5-12(11(13)7-9)20(17,18)14-8-10-3-2-6-19(10,15)16/h4-5,7,10,14H,2-3,6,8,13H2,1H3 |
| InChIKey | UWCFWVLXAJSSCE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|