C11H14BrNO4S2 — CID 97321593
2-bromo-N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]benzenesulfonamide (PubChem CID 97321593) has the molecular formula C11H14BrNO4S2 and a molecular weight of 368.27 g/mol. Its IUPAC name is 2-bromo-N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97321593 |
| Molecular Formula | C11H14BrNO4S2 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2-bromo-N-[[(2R)-1,1-dioxothiolan-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@H]1CCCS1(=O)=O)c1ccccc1Br |
| InChI | InChI=1S/C11H14BrNO4S2/c12-10-5-1-2-6-11(10)19(16,17)13-8-9-4-3-7-18(9,14)15/h1-2,5-6,9,13H,3-4,7-8H2/t9-/m1/s1 |
| InChIKey | TYIXQUHPWNALBV-SECBINFHSA-N |
| XLogP | 1.30 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |