C11H14F2N2O4S2 — CID 81043484
4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-2,6-difluorobenzenesulfonamide (PubChem CID 81043484) has the molecular formula C11H14F2N2O4S2 and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 81043484 |
| Molecular Formula | C11H14F2N2O4S2 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 4-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-2,6-difluorobenzenesulfonamide |
| SMILES | Nc1cc(F)c(S(=O)(=O)NCC2CCCS2(=O)=O)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O4S2/c12-9-4-7(14)5-10(13)11(9)21(18,19)15-6-8-2-1-3-20(8,16)17/h4-5,8,15H,1-3,6,14H2 |
| InChIKey | CQOFXIJUCOJMHJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|