C9H13N3O6S3 — CID 81043065
5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 81043065) has the molecular formula C9H13N3O6S3 and a molecular weight of 355.42 g/mol. Its IUPAC name is 5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 81043065 |
| Molecular Formula | C9H13N3O6S3 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 5-amino-N-[(1,1-dioxothiolan-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)NCC2CCCS2(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O6S3/c10-9-7(12(13)14)4-8(19-9)21(17,18)11-5-6-2-1-3-20(6,15)16/h4,6,11H,1-3,5,10H2 |
| InChIKey | XRIPFBYGSXUGDR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|