C6H9N3O4S2 — CID 80747001
5-amino-N-ethyl-4-nitrothiophene-2-sulfonamide (PubChem CID 80747001) has the molecular formula C6H9N3O4S2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 5-amino-N-ethyl-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-ethyl-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80747001 |
| Molecular Formula | C6H9N3O4S2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 5-amino-N-ethyl-4-nitrothiophene-2-sulfonamide |
| SMILES | CCNS(=O)(=O)c1cc([N+](=O)[O-])c(N)s1 |
| InChI | InChI=1S/C6H9N3O4S2/c1-2-8-15(12,13)5-3-4(9(10)11)6(7)14-5/h3,8H,2,7H2,1H3 |
| InChIKey | YFUPNGNODONPNN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|