C7H8F3N3O4S3 — CID 106432828
5-amino-4-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-2-sulfonamide (PubChem CID 106432828) has the molecular formula C7H8F3N3O4S3 and a molecular weight of 351.35 g/mol. Its IUPAC name is 5-amino-4-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-amino-4-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106432828 |
| Molecular Formula | C7H8F3N3O4S3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 5-amino-4-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]thiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)NCCSC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H8F3N3O4S3/c8-7(9,10)18-2-1-12-20(16,17)5-3-4(13(14)15)6(11)19-5/h3,12H,1-2,11H2 |
| InChIKey | GFVNOAYWKPFGGZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|