C9H12F3N3O4S2 — CID 115522052
5-amino-4-nitro-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide (PubChem CID 115522052) has the molecular formula C9H12F3N3O4S2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 5-amino-4-nitro-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide.
| Compound Name | 5-amino-4-nitro-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 115522052 |
| Molecular Formula | C9H12F3N3O4S2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 5-amino-4-nitro-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)NCCCCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12F3N3O4S2/c10-9(11,12)3-1-2-4-14-21(18,19)7-5-6(15(16)17)8(13)20-7/h5,14H,1-4,13H2 |
| InChIKey | WZICXIBEKRFFCR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|