C8H10F3N3O4S2 — CID 80747707
5-(methylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide (PubChem CID 80747707) has the molecular formula C8H10F3N3O4S2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 5-(methylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide.
| Compound Name | 5-(methylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80747707 |
| Molecular Formula | C8H10F3N3O4S2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 5-(methylamino)-4-nitro-N-(3,3,3-trifluoropropyl)thiophene-2-sulfonamide |
| SMILES | CNc1sc(S(=O)(=O)NCCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10F3N3O4S2/c1-12-7-5(14(15)16)4-6(19-7)20(17,18)13-3-2-8(9,10)11/h4,12-13H,2-3H2,1H3 |
| InChIKey | MPFFZWKZGKSQGO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|