C11H13N3O4S3 — CID 80727859
5-(methylamino)-N-[(3-methylthiophen-2-yl)methyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 80727859) has the molecular formula C11H13N3O4S3 and a molecular weight of 347.44 g/mol. Its IUPAC name is 5-(methylamino)-N-[(3-methylthiophen-2-yl)methyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-(methylamino)-N-[(3-methylthiophen-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80727859 |
| Molecular Formula | C11H13N3O4S3 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 5-(methylamino)-N-[(3-methylthiophen-2-yl)methyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | CNc1sc(S(=O)(=O)NCc2sccc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O4S3/c1-7-3-4-19-9(7)6-13-21(17,18)10-5-8(14(15)16)11(12-2)20-10/h3-5,12-13H,6H2,1-2H3 |
| InChIKey | GOCCGWRPHZXXHZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|