C9H12N6O4S2 — CID 80727588
5-(methylamino)-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 80727588) has the molecular formula C9H12N6O4S2 and a molecular weight of 332.37 g/mol. Its IUPAC name is 5-(methylamino)-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-(methylamino)-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80727588 |
| Molecular Formula | C9H12N6O4S2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-(methylamino)-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CNc1sc(S(=O)(=O)NCCc2ncn[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N6O4S2/c1-10-9-6(15(16)17)4-8(20-9)21(18,19)13-3-2-7-11-5-12-14-7/h4-5,10,13H,2-3H2,1H3,(H,11,12,14) |
| InChIKey | AYZXIGXMQFTORE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|