C8H10N6O4S2 — CID 80746615
5-amino-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 80746615) has the molecular formula C8H10N6O4S2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-amino-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-amino-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80746615 |
| Molecular Formula | C8H10N6O4S2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 5-amino-4-nitro-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)NCCc2ncn[nH]2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N6O4S2/c9-8-5(14(15)16)3-7(19-8)20(17,18)12-2-1-6-10-4-11-13-6/h3-4,12H,1-2,9H2,(H,10,11,13) |
| InChIKey | IADQGRGKMNMKKD-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|