C10H12N4O4S3 — CID 106049683
5-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-nitrothiophene-2-sulfonamide (PubChem CID 106049683) has the molecular formula C10H12N4O4S3 and a molecular weight of 348.43 g/mol. Its IUPAC name is 5-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106049683 |
| Molecular Formula | C10H12N4O4S3 |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 5-amino-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1nc(CCNS(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)cs1 |
| InChI | InChI=1S/C10H12N4O4S3/c1-6-13-7(5-19-6)2-3-12-21(17,18)9-4-8(14(15)16)10(11)20-9/h4-5,12H,2-3,11H2,1H3 |
| InChIKey | FWLYFTHCYWUKKD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|