C9H10N6O4S2 — CID 114389272
5-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-nitrothiophene-2-sulfonamide (PubChem CID 114389272) has the molecular formula C9H10N6O4S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 5-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114389272 |
| Molecular Formula | C9H10N6O4S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 5-amino-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-4-nitrothiophene-2-sulfonamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2cc([N+](=O)[O-])c(N)s2)nc1C |
| InChI | InChI=1S/C9H10N6O4S2/c1-4-5(2)12-13-9(11-4)14-21(18,19)7-3-6(15(16)17)8(10)20-7/h3H,10H2,1-2H3,(H,11,13,14) |
| InChIKey | GNVGGPXGGYYUJF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 154.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|