C10H7F2N3O4S2 — CID 80744953
5-amino-N-(3,5-difluorophenyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80744953) has the molecular formula C10H7F2N3O4S2 and a molecular weight of 335.31 g/mol. Its IUPAC name is 5-amino-N-(3,5-difluorophenyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-amino-N-(3,5-difluorophenyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80744953 |
| Molecular Formula | C10H7F2N3O4S2 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 5-amino-N-(3,5-difluorophenyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)Nc2cc(F)cc(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7F2N3O4S2/c11-5-1-6(12)3-7(2-5)14-21(18,19)9-4-8(15(16)17)10(13)20-9/h1-4,14H,13H2 |
| InChIKey | VUAVVNLJLLBTKB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|