C7H6N4O5S2 — CID 80746819
5-amino-4-nitro-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide (PubChem CID 80746819) has the molecular formula C7H6N4O5S2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-amino-4-nitro-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-amino-4-nitro-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80746819 |
| Molecular Formula | C7H6N4O5S2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 5-amino-4-nitro-N-(1,2-oxazol-3-yl)thiophene-2-sulfonamide |
| SMILES | Nc1sc(S(=O)(=O)Nc2ccon2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N4O5S2/c8-7-4(11(12)13)3-6(17-7)18(14,15)10-5-1-2-16-9-5/h1-3H,8H2,(H,9,10) |
| InChIKey | BVEUSPZDHDFPBV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|