C9H8N4O5S — CID 62902722
5-amino-2-nitro-N-(1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 62902722) has the molecular formula C9H8N4O5S and a molecular weight of 284.25 g/mol. Its IUPAC name is 5-amino-2-nitro-N-(1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-nitro-N-(1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62902722 |
| Molecular Formula | C9H8N4O5S |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-amino-2-nitro-N-(1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | Nc1ccc([N+](=O)[O-])c(S(=O)(=O)Nc2ccon2)c1 |
| InChI | InChI=1S/C9H8N4O5S/c10-6-1-2-7(13(14)15)8(5-6)19(16,17)12-9-3-4-18-11-9/h1-5H,10H2,(H,11,12) |
| InChIKey | MNPLWSXPCGMAMY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|