C10H9N3O5S — CID 102931209
4-amino-2-(1,2-oxazol-3-ylsulfamoyl)benzoic acid (PubChem CID 102931209) has the molecular formula C10H9N3O5S and a molecular weight of 283.26 g/mol. Its IUPAC name is 4-amino-2-(1,2-oxazol-3-ylsulfamoyl)benzoic acid.
| Compound Name | 4-amino-2-(1,2-oxazol-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102931209 |
| Molecular Formula | C10H9N3O5S |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 4-amino-2-(1,2-oxazol-3-ylsulfamoyl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)Nc2ccon2)c1 |
| InChI | InChI=1S/C10H9N3O5S/c11-6-1-2-7(10(14)15)8(5-6)19(16,17)13-9-3-4-18-12-9/h1-5H,11H2,(H,12,13)(H,14,15) |
| InChIKey | NJAFNOGZAPMSGZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|