C9H8N2O5S2 — CID 60681193
2-[5-(1,2-oxazol-3-ylsulfamoyl)thiophen-2-yl]acetic acid (PubChem CID 60681193) has the molecular formula C9H8N2O5S2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[5-(1,2-oxazol-3-ylsulfamoyl)thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-(1,2-oxazol-3-ylsulfamoyl)thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 60681193 |
| Molecular Formula | C9H8N2O5S2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 2-[5-(1,2-oxazol-3-ylsulfamoyl)thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)Nc2ccon2)s1 |
| InChI | InChI=1S/C9H8N2O5S2/c12-8(13)5-6-1-2-9(17-6)18(14,15)11-7-3-4-16-10-7/h1-4H,5H2,(H,10,11)(H,12,13) |
| InChIKey | KFERVUHRRIBBQM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |