C12H13N3O4S2 — CID 29267010
2-[5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]thiophen-2-yl]acetic acid (PubChem CID 29267010) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 29267010 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-[5-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]thiophen-2-yl]acetic acid |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(CC(=O)O)s2)n1 |
| InChI | InChI=1S/C12H13N3O4S2/c1-7-5-8(2)14-12(13-7)15-21(18,19)11-4-3-9(20-11)6-10(16)17/h3-5H,6H2,1-2H3,(H,16,17)(H,13,14,15) |
| InChIKey | BIWZBOMWOXBJAF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |