C10H8N4O3S — CID 62902060
4-amino-2-cyano-N-(1,2-oxazol-3-yl)benzenesulfonamide (PubChem CID 62902060) has the molecular formula C10H8N4O3S and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-amino-2-cyano-N-(1,2-oxazol-3-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-cyano-N-(1,2-oxazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62902060 |
| Molecular Formula | C10H8N4O3S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 4-amino-2-cyano-N-(1,2-oxazol-3-yl)benzenesulfonamide |
| SMILES | N#Cc1cc(N)ccc1S(=O)(=O)Nc1ccon1 |
| InChI | InChI=1S/C10H8N4O3S/c11-6-7-5-8(12)1-2-9(7)18(15,16)14-10-3-4-17-13-10/h1-5H,12H2,(H,13,14) |
| InChIKey | RQDOFKAXSTZOBB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|