C9H11N3O2S — CID 43256213
4-amino-2-cyano-N,N-dimethylbenzenesulfonamide (PubChem CID 43256213) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 4-amino-2-cyano-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-2-cyano-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43256213 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 4-amino-2-cyano-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)cc1C#N |
| InChI | InChI=1S/C9H11N3O2S/c1-12(2)15(13,14)9-4-3-8(11)5-7(9)6-10/h3-5H,11H2,1-2H3 |
| InChIKey | NHKOQUADKSHTPH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|