C14H18N4O2S — CID 61139569
4-amino-2-cyano-N-(2-cyanoethyl)-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 61139569) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-amino-2-cyano-N-(2-cyanoethyl)-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-2-cyano-N-(2-cyanoethyl)-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61139569 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-amino-2-cyano-N-(2-cyanoethyl)-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CCC#N)S(=O)(=O)c1ccc(N)cc1C#N |
| InChI | InChI=1S/C14H18N4O2S/c1-11(2)10-18(7-3-6-15)21(19,20)14-5-4-13(17)8-12(14)9-16/h4-5,8,11H,3,7,10,17H2,1-2H3 |
| InChIKey | GDMGUNNXHWZMSL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|