C13H17ClFN3O2S — CID 103050911
3-amino-5-chloro-N-(2-cyanoethyl)-2-fluoro-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 103050911) has the molecular formula C13H17ClFN3O2S and a molecular weight of 333.82 g/mol. Its IUPAC name is 3-amino-5-chloro-N-(2-cyanoethyl)-2-fluoro-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-(2-cyanoethyl)-2-fluoro-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103050911 |
| Molecular Formula | C13H17ClFN3O2S |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-amino-5-chloro-N-(2-cyanoethyl)-2-fluoro-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CCC#N)S(=O)(=O)c1cc(Cl)cc(N)c1F |
| InChI | InChI=1S/C13H17ClFN3O2S/c1-9(2)8-18(5-3-4-16)21(19,20)12-7-10(14)6-11(17)13(12)15/h6-7,9H,3,5,8,17H2,1-2H3 |
| InChIKey | UQOCDPHCAJPZHP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|