C15H23N3O2S — CID 61138618
3-amino-N-(2-cyanoethyl)-4,5-dimethyl-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 61138618) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-amino-N-(2-cyanoethyl)-4,5-dimethyl-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-N-(2-cyanoethyl)-4,5-dimethyl-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 61138618 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-amino-N-(2-cyanoethyl)-4,5-dimethyl-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCC#N)CC(C)C)cc(N)c1C |
| InChI | InChI=1S/C15H23N3O2S/c1-11(2)10-18(7-5-6-16)21(19,20)14-8-12(3)13(4)15(17)9-14/h8-9,11H,5,7,10,17H2,1-4H3 |
| InChIKey | QEJGHOVPLOKLGX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|