About 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide
3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide (PubChem CID 29277771) has the molecular formula C12H14N4O2S
and a molecular weight of 278.34 g/mol. Its IUPAC name is 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide |
| PubChem CID | 29277771 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(CC#N)CC#N)cc(N)c1C |
| InChI | InChI=1S/C12H14N4O2S/c1-9-7-11(8-12(15)10(9)2)19(17,18)16(5-3-13)6-4-14/h7-8H,5-6,15H2,1-2H3 |
| InChIKey | XHJVYDDEVDBWHC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide?
The IUPAC name of 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide (CID 29277771) is 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide.
What is the SMILES notation for 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide?
The canonical SMILES for 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide is Cc1cc(S(=O)(=O)N(CC#N)CC#N)cc(N)c1C.
What is the InChIKey of 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide?
The InChIKey is XHJVYDDEVDBWHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c1-9-7-11(8-12(15)10(9)2)19(17,18)16(5-3-13)6-4-14/h7-8H,5-6,15H2,1-2H3.
What are the key properties of 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide?
3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide has a molecular weight of 278.34 g/mol, XLogP of 0.92, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-bis(cyanomethyl)-4,5-dimethylbenzenesulfonamide is sourced from PubChem (CID 29277771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).