C14H19N3O2S — CID 61126052
3-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,5-dimethylbenzenesulfonamide (PubChem CID 61126052) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,5-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 61126052 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 3-amino-N-(2-cyanoethyl)-N-cyclopropyl-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCC#N)C2CC2)cc(N)c1C |
| InChI | InChI=1S/C14H19N3O2S/c1-10-8-13(9-14(16)11(10)2)20(18,19)17(7-3-6-15)12-4-5-12/h8-9,12H,3-5,7,16H2,1-2H3 |
| InChIKey | UPDOVQVTNPDKPH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|