C12H14FN3O2S — CID 82843646
4-amino-N-(2-cyanoethyl)-N-cyclopropyl-3-fluorobenzenesulfonamide (PubChem CID 82843646) has the molecular formula C12H14FN3O2S and a molecular weight of 283.33 g/mol. Its IUPAC name is 4-amino-N-(2-cyanoethyl)-N-cyclopropyl-3-fluorobenzenesulfonamide.
| Compound Name | 4-amino-N-(2-cyanoethyl)-N-cyclopropyl-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 82843646 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 4-amino-N-(2-cyanoethyl)-N-cyclopropyl-3-fluorobenzenesulfonamide |
| SMILES | N#CCCN(C1CC1)S(=O)(=O)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C12H14FN3O2S/c13-11-8-10(4-5-12(11)15)19(17,18)16(7-1-6-14)9-2-3-9/h4-5,8-9H,1-3,7,15H2 |
| InChIKey | CHYNZPYYSAKRPK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|