C11H14F2N2O2S — CID 61350715
N-(2-aminoethyl)-N-cyclopropyl-3,4-difluorobenzenesulfonamide (PubChem CID 61350715) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-cyclopropyl-3,4-difluorobenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-N-cyclopropyl-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 61350715 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(2-aminoethyl)-N-cyclopropyl-3,4-difluorobenzenesulfonamide |
| SMILES | NCCN(C1CC1)S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O2S/c12-10-4-3-9(7-11(10)13)18(16,17)15(6-5-14)8-1-2-8/h3-4,7-8H,1-2,5-6,14H2 |
| InChIKey | XHOQYMBSJKUUBV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |