C12H17FN2O4S2 — CID 61350717
N-(2-aminoethyl)-N-cyclopropyl-2-fluoro-5-methylsulfonylbenzenesulfonamide (PubChem CID 61350717) has the molecular formula C12H17FN2O4S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-cyclopropyl-2-fluoro-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-aminoethyl)-N-cyclopropyl-2-fluoro-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 61350717 |
| Molecular Formula | C12H17FN2O4S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-(2-aminoethyl)-N-cyclopropyl-2-fluoro-5-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)N(CCN)C2CC2)c1 |
| InChI | InChI=1S/C12H17FN2O4S2/c1-20(16,17)10-4-5-11(13)12(8-10)21(18,19)15(7-6-14)9-2-3-9/h4-5,8-9H,2-3,6-7,14H2,1H3 |
| InChIKey | XIVPLYCVZQSHKC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |