C12H16F2N2O2S — CID 107343147
3-amino-N-cyclopropyl-2,4-difluoro-N-propylbenzenesulfonamide (PubChem CID 107343147) has the molecular formula C12H16F2N2O2S and a molecular weight of 290.33 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-2,4-difluoro-N-propylbenzenesulfonamide.
| Compound Name | 3-amino-N-cyclopropyl-2,4-difluoro-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 107343147 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-amino-N-cyclopropyl-2,4-difluoro-N-propylbenzenesulfonamide |
| SMILES | CCCN(C1CC1)S(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C12H16F2N2O2S/c1-2-7-16(8-3-4-8)19(17,18)10-6-5-9(13)12(15)11(10)14/h5-6,8H,2-4,7,15H2,1H3 |
| InChIKey | XOPORSDHIQMVOC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|