C14H20F2N2O2S — CID 107343235
3-amino-N-cycloheptyl-2,4-difluoro-N-methylbenzenesulfonamide (PubChem CID 107343235) has the molecular formula C14H20F2N2O2S and a molecular weight of 318.39 g/mol. Its IUPAC name is 3-amino-N-cycloheptyl-2,4-difluoro-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-cycloheptyl-2,4-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107343235 |
| Molecular Formula | C14H20F2N2O2S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-amino-N-cycloheptyl-2,4-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCCCCC1)S(=O)(=O)c1ccc(F)c(N)c1F |
| InChI | InChI=1S/C14H20F2N2O2S/c1-18(10-6-4-2-3-5-7-10)21(19,20)12-9-8-11(15)14(17)13(12)16/h8-10H,2-7,17H2,1H3 |
| InChIKey | ICQYXZGDTPTMGF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|