C14H20FNO2S — CID 892144
N-cyclohexyl-4-fluoro-N,3-dimethylbenzenesulfonamide (PubChem CID 892144) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-N,3-dimethylbenzenesulfonamide.
| Compound Name | N-cyclohexyl-4-fluoro-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 892144 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-cyclohexyl-4-fluoro-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CCCCC2)ccc1F |
| InChI | InChI=1S/C14H20FNO2S/c1-11-10-13(8-9-14(11)15)19(17,18)16(2)12-6-4-3-5-7-12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | RMXOXURBXNTQOW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |