C14H19F2NO2S — CID 55476609
N-cycloheptyl-3,5-difluoro-N-methylbenzenesulfonamide (PubChem CID 55476609) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is N-cycloheptyl-3,5-difluoro-N-methylbenzenesulfonamide.
| Compound Name | N-cycloheptyl-3,5-difluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55476609 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-cycloheptyl-3,5-difluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCCCCC1)S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-17(13-6-4-2-3-5-7-13)20(18,19)14-9-11(15)8-12(16)10-14/h8-10,13H,2-7H2,1H3 |
| InChIKey | TVLXFUVQRMABGZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |