C16H24FNO2S — CID 107326759
N-cycloheptyl-4-fluoro-N,2,6-trimethylbenzenesulfonamide (PubChem CID 107326759) has the molecular formula C16H24FNO2S and a molecular weight of 313.44 g/mol. Its IUPAC name is N-cycloheptyl-4-fluoro-N,2,6-trimethylbenzenesulfonamide.
| Compound Name | N-cycloheptyl-4-fluoro-N,2,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107326759 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-cycloheptyl-4-fluoro-N,2,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N(C)C1CCCCCC1 |
| InChI | InChI=1S/C16H24FNO2S/c1-12-10-14(17)11-13(2)16(12)21(19,20)18(3)15-8-6-4-5-7-9-15/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | SYHABMXMILZXDK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |