C15H22FNO2S — CID 107326676
N-cycloheptyl-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107326676) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is N-cycloheptyl-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-cycloheptyl-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107326676 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-cycloheptyl-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C15H22FNO2S/c1-11-9-13(16)10-12(2)15(11)20(18,19)17-14-7-5-3-4-6-8-14/h9-10,14,17H,3-8H2,1-2H3 |
| InChIKey | LYLVWLMRCVHDPV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |