C14H21FN2O2S — CID 107585309
4-fluoro-2,6-dimethyl-N-(5-methylpiperidin-3-yl)benzenesulfonamide (PubChem CID 107585309) has the molecular formula C14H21FN2O2S and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-(5-methylpiperidin-3-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-(5-methylpiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107585309 |
| Molecular Formula | C14H21FN2O2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-(5-methylpiperidin-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NC1CNCC(C)C1 |
| InChI | InChI=1S/C14H21FN2O2S/c1-9-4-13(8-16-7-9)17-20(18,19)14-10(2)5-12(15)6-11(14)3/h5-6,9,13,16-17H,4,7-8H2,1-3H3 |
| InChIKey | OBBZCGVBPGVVDZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |