C14H12F3NO2S — CID 107326533
N-(3,5-difluorophenyl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107326533) has the molecular formula C14H12F3NO2S and a molecular weight of 315.32 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(3,5-difluorophenyl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107326533 |
| Molecular Formula | C14H12F3NO2S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(3,5-difluorophenyl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H12F3NO2S/c1-8-3-10(15)4-9(2)14(8)21(19,20)18-13-6-11(16)5-12(17)7-13/h3-7,18H,1-2H3 |
| InChIKey | NLVVMADRPNBNRB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |