C14H14FNO3S — CID 107326957
4-fluoro-N-(3-hydroxyphenyl)-2,6-dimethylbenzenesulfonamide (PubChem CID 107326957) has the molecular formula C14H14FNO3S and a molecular weight of 295.33 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxyphenyl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-(3-hydroxyphenyl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107326957 |
| Molecular Formula | C14H14FNO3S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 4-fluoro-N-(3-hydroxyphenyl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C14H14FNO3S/c1-9-6-11(15)7-10(2)14(9)20(18,19)16-12-4-3-5-13(17)8-12/h3-8,16-17H,1-2H3 |
| InChIKey | PNCQNWFHLOSTKG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |