C13H13FN2O3S — CID 107327732
4-fluoro-N-(3-hydroxy-2-pyridinyl)-2,6-dimethylbenzenesulfonamide (PubChem CID 107327732) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-fluoro-N-(3-hydroxy-2-pyridinyl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-(3-hydroxy-2-pyridinyl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107327732 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-fluoro-N-(3-hydroxy-2-pyridinyl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)Nc1ncccc1O |
| InChI | InChI=1S/C13H13FN2O3S/c1-8-6-10(14)7-9(2)12(8)20(18,19)16-13-11(17)4-3-5-15-13/h3-7,17H,1-2H3,(H,15,16) |
| InChIKey | SAJBJCUOJVDPEH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |