C14H15FN2O2S — CID 107326525
4-fluoro-2,6-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 107326525) has the molecular formula C14H15FN2O2S and a molecular weight of 294.35 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107326525 |
| Molecular Formula | C14H15FN2O2S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCc1ccccn1 |
| InChI | InChI=1S/C14H15FN2O2S/c1-10-7-12(15)8-11(2)14(10)20(18,19)17-9-13-5-3-4-6-16-13/h3-8,17H,9H2,1-2H3 |
| InChIKey | XNXXPCFHKXDZFV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |