C15H17FN2O2S — CID 107326770
4-fluoro-2,6-dimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide (PubChem CID 107326770) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2,6-dimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107326770 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-N-(2-pyridin-4-ylethyl)benzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NCCc1ccncc1 |
| InChI | InChI=1S/C15H17FN2O2S/c1-11-9-14(16)10-12(2)15(11)21(19,20)18-8-5-13-3-6-17-7-4-13/h3-4,6-7,9-10,18H,5,8H2,1-2H3 |
| InChIKey | QXMAJOKEFVKJFX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |