C12H17FN2O3S — CID 107326734
N-[2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 107326734) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is N-[2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | N-[2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 107326734 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C12H17FN2O3S/c1-8-6-11(13)7-9(2)12(8)19(17,18)15-5-4-14-10(3)16/h6-7,15H,4-5H2,1-3H3,(H,14,16) |
| InChIKey | HPAUQIJBRAMBMO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|