C10H13FN2O3S — CID 107326948
N'-(4-fluoro-2,6-dimethylphenyl)sulfonylacetohydrazide (PubChem CID 107326948) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is N'-(4-fluoro-2,6-dimethylphenyl)sulfonylacetohydrazide.
| Compound Name | N'-(4-fluoro-2,6-dimethylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 107326948 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N'-(4-fluoro-2,6-dimethylphenyl)sulfonylacetohydrazide |
| SMILES | CC(=O)NNS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C10H13FN2O3S/c1-6-4-9(11)5-7(2)10(6)17(15,16)13-12-8(3)14/h4-5,13H,1-3H3,(H,12,14) |
| InChIKey | FAUPHPKNJAYQMQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|