C13H18FNO4S — CID 107327014
ethyl 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]propanoate (PubChem CID 107327014) has the molecular formula C13H18FNO4S and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]propanoate.
| Compound Name | ethyl 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 107327014 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | ethyl 2-[(4-fluoro-2,6-dimethylphenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)C(C)NS(=O)(=O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C13H18FNO4S/c1-5-19-13(16)10(4)15-20(17,18)12-8(2)6-11(14)7-9(12)3/h6-7,10,15H,5H2,1-4H3 |
| InChIKey | NZYOCPASFGLMMS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |